CAS 1240526-15-1

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, α-methyl-N-(2-methylbutyl)-, hydrochloride (1:2)

Description:

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, α-methyl-N-(2-methylbutyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, making it of interest in medicinal chemistry and pharmacology. The presence of the α-methyl group and the 2-methylbutyl substituent suggests potential lipophilicity, which may influence its bioavailability and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications. The compound may exhibit biological activity, potentially acting as a ligand or inhibitor in specific biochemical pathways. Its unique structural features and potential pharmacological properties make it a candidate for further research in drug development and therapeutic applications. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₃H₂₀N₄·2ClH

InChI: InChI=1S/C13H20N4.2ClH/c1-4-10(2)9-14-11(3)13-16-15-12-7-5-6-8-17(12)13;;/h5-8,10-11,14H,4,9H2,1-3H3;2*1H

InChI key: InChIKey=ZJHUDWULZJZPMS-UHFFFAOYSA-N

SMILES: C(NCC(CC)C)(C)C=1N2C(=NN1)C=CC=C2.Cl

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, α-methyl-N-(2-methylbutyl)-, hydrochloride (1:2)