CAS 1240526-17-3

Benzeneacetonitrile, α-amino-5-bromo-2-fluoro-, hydrochloride (1:1)

Description:

Benzeneacetonitrile, α-amino-5-bromo-2-fluoro-, hydrochloride (1:1), with CAS number 1240526-17-3, is a chemical compound characterized by its structural features that include a benzene ring, an acetonitrile group, and amino functionalities. The presence of bromine and fluorine substituents on the aromatic ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical research. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its structural motifs that can interact with biological targets. Its specific characteristics, such as melting point, boiling point, and spectral data, would need to be referenced from experimental data or literature for precise applications. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₆BrFN₂·ClH

InChI: InChI=1S/C8H6BrFN2.ClH/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-3,8H,12H2;1H

InChI key: InChIKey=MFAHZTFSPSNZFW-UHFFFAOYSA-N

SMILES: C(C#N)(N)C1=C(F)C=CC(Br)=C1.Cl

Synonyms:

• Benzeneacetonitrile, α-amino-5-bromo-2-fluoro-, hydrochloride (1:1)

2-Amino-2-(5-bromo-2-fluorophenyl)acetonitrile hydrochloride

CAS: 1240526-17-3

Versatile small molecule scaffold

Formula: C₈H₇BrClFN₂

Purity: Min. 95%

Molecular weight: 265.51 g/mol

Ref: 3D-QZB52617