CAS 1240526-18-4

5-Chloro-6-[(3,4-difluorophenyl)amino]-3-pyridinecarbonitrile

Description:

5-Chloro-6-[(3,4-difluorophenyl)amino]-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a chloro substituent, and an amino group attached to a difluorophenyl moiety. This compound features a carbonitrile functional group, contributing to its potential reactivity and applications in various chemical processes. The presence of chlorine and fluorine atoms in its structure may influence its electronic properties, making it of interest in medicinal chemistry and material science. The compound's molecular framework suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other reagents. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in drug development and synthetic chemistry.

Formula: C₁₂H₆ClF₂N₃

InChI: InChI=1S/C12H6ClF2N3/c13-9-3-7(5-16)6-17-12(9)18-8-1-2-10(14)11(15)4-8/h1-4,6H,(H,17,18)

InChI key: InChIKey=PXJCFORPLGOVNK-UHFFFAOYSA-N

SMILES: N(C1=C(Cl)C=C(C#N)C=N1)C2=CC(F)=C(F)C=C2

Synonyms:

• 3-Pyridinecarbonitrile, 5-chloro-6-[(3,4-difluorophenyl)amino]-
• 5-Chloro-6-[(3,4-difluorophenyl)amino]-3-pyridinecarbonitrile

5-Chloro-6-[(3,4-difluorophenyl)amino]pyridine-3-carbonitrile

CAS: 1240526-18-4

Versatile small molecule scaffold

Formula: C₁₂H₆ClF₂N₃

Purity: Min. 95%

Molecular weight: 265.64 g/mol

Ref: 3D-QZB52618