CAS 1240526-21-9

Methyl 1-(2-chlorophenyl)-4-formyl-1H-pyrrole-2-carboxylate

Description:

Methyl 1-(2-chlorophenyl)-4-formyl-1H-pyrrole-2-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrole ring, a carboxylate group, and a chlorophenyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the formyl group. The chlorophenyl moiety may impart unique electronic properties, influencing its reactivity and interactions in various chemical environments. Methyl esters like this compound are often used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The presence of the formyl group suggests potential for further functionalization, making it a versatile building block in synthetic chemistry. Additionally, the compound's solubility and stability can vary based on the solvent and conditions, which is crucial for its application in laboratory settings. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, contributing to its potential utility in various chemical applications.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c1-18-13(17)12-6-9(8-16)7-15(12)11-5-3-2-4-10(11)14/h2-8H,1H3

InChI key: InChIKey=VOPQMGAQDIYIRJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N(C=C(C=O)C1)C2=C(Cl)C=CC=C2

Synonyms:

• Methyl 1-(2-chlorophenyl)-4-formyl-1H-pyrrole-2-carboxylate
• 1H-Pyrrole-2-carboxylic acid, 1-(2-chlorophenyl)-4-formyl-, methyl ester