CAS 1240526-33-3

3-Thiophenamine, tetrahydro-4-(1-piperidinyl)-, 1,1-dioxide, hydrochloride (1:2)

Description:

3-Thiophenamine, tetrahydro-4-(1-piperidinyl)-, 1,1-dioxide, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a thiophene ring and a piperidine moiety. The presence of the 1,1-dioxide functional group indicates that it contains a sulfone, contributing to its potential reactivity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its bioavailability in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. The compound's characteristics, such as melting point, solubility, and stability, would depend on its specific formulation and environmental conditions. Overall, 3-Thiophenamine, tetrahydro-4-(1-piperidinyl)-, 1,1-dioxide, hydrochloride (1:2) represents a class of compounds that may have significant implications in drug development and research.

Formula: C₉H₁₈N₂O₂S·2ClH

InChI: InChI=1S/C9H18N2O2S.2ClH/c10-8-6-14(12,13)7-9(8)11-4-2-1-3-5-11;;/h8-9H,1-7,10H2;2*1H

InChI key: InChIKey=SDKNFYXNZAEMQD-UHFFFAOYSA-N

SMILES: NC1C(CS(=O)(=O)C1)N2CCCCC2.Cl

Synonyms:

• 3-Thiophenamine, tetrahydro-4-(1-piperidinyl)-, 1,1-dioxide, hydrochloride (1:2)

1,1-Dioxo-4-piperidin-1-ylthiolan-3-amine dihydrochloride

CAS: 1240526-33-3

Versatile small molecule scaffold

Formula: C₉H₂₀Cl₂N₂O₂S

Purity: Min. 95%

Molecular weight: 291.24 g/mol

Ref: 3D-QZB52633