CAS 1240526-34-4

2-Benzothiazoleethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)

Description:

2-Benzothiazoleethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety and an ethylamine side chain. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often studied for its potential biological activities, including effects on neurotransmitter systems, making it of interest in medicinal chemistry and pharmacology. The presence of the tetrahydro group suggests that it may exhibit specific stereochemical properties that could influence its interaction with biological targets. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₁₄N₂S·2ClH

InChI: InChI=1S/C9H14N2S.2ClH/c10-6-5-9-11-7-3-1-2-4-8(7)12-9;;/h1-6,10H2;2*1H

InChI key: InChIKey=ZPJDDZJQZTXSIX-UHFFFAOYSA-N

SMILES: C(CN)C1=NC2=C(S1)CCCC2.Cl

Synonyms:

• 2-Benzothiazoleethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)