CymitQuimica logo

CAS 1240526-43-5

:

1H-Benzimidazole, 6-bromo-2-(1-chloroethyl)-, hydrochloride (1:1)

Description:
1H-Benzimidazole, 6-bromo-2-(1-chloroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a bromo substituent at the 6-position and a chloroethyl group at the 2-position contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may be investigated for its efficacy in treating specific conditions. Safety and handling precautions are essential due to the presence of halogenated groups, which can pose toxicity risks. Overall, this compound represents a class of heterocyclic compounds that are significant in drug development and chemical research.
Formula:C9H8BrClN2·ClH
InChI:InChI=1S/C9H8BrClN2.ClH/c1-5(11)9-12-7-3-2-6(10)4-8(7)13-9;/h2-5H,1H3,(H,12,13);1H
InChI key:InChIKey=PECALOUHICJINU-UHFFFAOYSA-N
SMILES:C(C)(Cl)C=1NC=2C(N1)=CC(Br)=CC2.Cl
Synonyms:
  • 1H-Benzimidazole, 6-bromo-2-(1-chloroethyl)-, hydrochloride (1:1)
Found 1 products.