CAS 1240526-44-6

1-Phenyl-1H-pyrazole-3-ethanamine

Description:

1-Phenyl-1H-pyrazole-3-ethanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a phenyl group attached to the pyrazole ring, contributing to its aromatic properties. The presence of an ethanamine group indicates that it has an amine functional group, which can participate in hydrogen bonding and may influence its solubility and reactivity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and amine functionalities that can interact with biological targets. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest for further research. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-Phenyl-1H-pyrazole-3-ethanamine represents a versatile scaffold in organic synthesis and drug development.

Formula: C₁₁H₁₃N₃

InChI: InChI=1S/C11H13N3/c12-8-6-10-7-9-14(13-10)11-4-2-1-3-5-11/h1-5,7,9H,6,8,12H2

InChI key: InChIKey=URRPTBKQFRZAHO-UHFFFAOYSA-N

SMILES: C(CN)C1=NN(C=C1)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazole-3-ethanamine, 1-phenyl-
• 1-Phenyl-1H-pyrazole-3-ethanamine
• 2-(1-Phenyl-1H-pyrazol-3-yl)ethan-1-amine