
CAS 1240526-45-7
:1,3,4-Oxadiazole-2-methanol, 5-methyl-, 2-acetate
Description:
1,3,4-Oxadiazole-2-methanol, 5-methyl-, 2-acetate, identified by its CAS number 1240526-45-7, is a chemical compound that belongs to the oxadiazole family, which is characterized by a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms. This compound features a methanol group and an acetate moiety, contributing to its potential reactivity and solubility properties. Typically, oxadiazoles exhibit interesting biological activities, including antimicrobial and anti-inflammatory effects, making them of interest in medicinal chemistry. The presence of the methyl group at the 5-position may influence the compound's lipophilicity and biological interactions. Additionally, the acetate group can enhance the compound's stability and solubility in organic solvents. Overall, 1,3,4-Oxadiazole-2-methanol, 5-methyl-, 2-acetate is a versatile compound with potential applications in pharmaceuticals and agrochemicals, although specific properties such as melting point, boiling point, and spectral data would require further investigation for detailed characterization.
Formula:C6H8N2O3
InChI:InChI=1S/C6H8N2O3/c1-4-7-8-6(11-4)3-10-5(2)9/h3H2,1-2H3
InChI key:InChIKey=LQHPMEPSTMMRMT-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C=1OC(C)=NN1
Synonyms:- 1,3,4-Oxadiazole-2-methanol, 5-methyl-, 2-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.