CymitQuimica logo

CAS 1240526-48-0

:

3-(Chloromethyl)-4-ethyl-5-methyl-4H-1,2,4-triazole

Description:
3-(Chloromethyl)-4-ethyl-5-methyl-4H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of ethyl and methyl substituents contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, triazole derivatives are known for their applications in pharmaceuticals, particularly as antifungal agents and in agricultural chemistry as fungicides. The specific arrangement of substituents in this compound may also impart unique biological activities or properties. Additionally, the chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Overall, the structural features of 3-(Chloromethyl)-4-ethyl-5-methyl-4H-1,2,4-triazole suggest potential utility in various chemical and biological applications.
Formula:C6H10ClN3
InChI:InChI=1S/C6H10ClN3/c1-3-10-5(2)8-9-6(10)4-7/h3-4H2,1-2H3
InChI key:InChIKey=PMCGOOOQEXADJB-UHFFFAOYSA-N
SMILES:C(C)N1C(CCl)=NN=C1C
Synonyms:
  • 3-(Chloromethyl)-4-ethyl-5-methyl-4H-1,2,4-triazole
  • 4H-1,2,4-Triazole, 3-(chloromethyl)-4-ethyl-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.