CAS 1240526-55-9

6,8-Dichloroimidazo[1,2-a]pyridine-2-ethanethioamide

Description:

6,8-Dichloroimidazo[1,2-a]pyridine-2-ethanethioamide is a chemical compound characterized by its imidazo-pyridine structure, which incorporates two chlorine substituents at the 6 and 8 positions of the imidazo ring. This compound features a thioamide functional group, which is indicative of its potential reactivity and biological activity. The presence of chlorine atoms typically enhances lipophilicity and can influence the compound's interaction with biological targets. The thioamide group may contribute to its ability to form hydrogen bonds and participate in various chemical reactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as imidazo-pyridine derivatives are known for their diverse pharmacological properties. Additionally, the specific arrangement of atoms and functional groups in this molecule may affect its solubility, stability, and overall reactivity, making it a subject of study in various chemical and biological contexts.

Formula: C₉H₇Cl₂N₃S

InChI: InChI=1S/C9H7Cl2N3S/c10-5-1-7(11)9-13-6(2-8(12)15)4-14(9)3-5/h1,3-4H,2H2,(H2,12,15)

InChI key: InChIKey=CURPYPSEJIFOTB-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=C(CC(N)=S)N2)C=C(Cl)C1

Synonyms:

• 6,8-Dichloroimidazo[1,2-a]pyridine-2-ethanethioamide
• Imidazo[1,2-a]pyridine-2-ethanethioamide, 6,8-dichloro-

2-{6,8-Dichloroimidazo[1,2-a]pyridin-2-yl}ethanethioamide

CAS: 1240526-55-9

Versatile small molecule scaffold

Formula: C₉H₇Cl₂N₃S

Purity: Min. 95%

Molecular weight: 260.14 g/mol

Ref: 3D-QZB52655