CAS 1240526-56-0

1H-Benzimidazole, 2-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:2)

Description:

1H-Benzimidazole, 2-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of the hexahydro-1H-1,4-diazepin moiety indicates that it contains a saturated seven-membered ring with two nitrogen atoms, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, possibly influencing various physiological processes. The specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which the compound is handled and stored. Overall, this compound represents a class of heterocyclic compounds that are often explored for their diverse applications in pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₆N₄·2ClH

InChI: InChI=1S/C12H16N4.2ClH/c1-2-5-11-10(4-1)14-12(15-11)16-8-3-6-13-7-9-16;;/h1-2,4-5,13H,3,6-9H2,(H,14,15);2*1H

InChI key: InChIKey=KKBCIPBOJYKKGX-UHFFFAOYSA-N

SMILES: C=1(NC=2C(N1)=CC=CC2)N3CCCNCC3.Cl

Synonyms:

• 1H-Benzimidazole, 2-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:2)

2-(1,4-Diazepan-1-yl)-1H-1,3-benzodiazole dihydrochloride

CAS: 1240526-56-0

Versatile small molecule scaffold

Formula: C₁₂H₁₈Cl₂N₄

Purity: Min. 95%

Molecular weight: 289.2 g/mol

Ref: 3D-QZB52656