CymitQuimica logo

CAS 1240526-65-1

:

1-(2-Piperidinylmethyl)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid

Description:
1-(2-Piperidinylmethyl)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrrole ring substituted with a trifluoromethyl group and a piperidinylmethyl side chain. This compound is notable for its potential biological activity, often explored in medicinal chemistry for its role as a pharmacophore in drug development. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. Additionally, the carboxylic acid functional group contributes to its acidity and potential interactions with biological targets. The piperidine moiety may also play a role in receptor binding and selectivity. Overall, this compound's characteristics make it a subject of interest in the synthesis of novel therapeutic agents, particularly in the fields of neuroscience and pharmacology. Its specific interactions and efficacy would depend on further empirical studies and evaluations.
Formula:C12H15F3N2O2
InChI:InChI=1S/C12H15F3N2O2/c13-12(14,15)10-7-17(6-9(10)11(18)19)5-8-3-1-2-4-16-8/h6-8,16H,1-5H2,(H,18,19)
InChI key:InChIKey=UQHODNJCIKJHTH-UHFFFAOYSA-N
SMILES:C(N1C=C(C(F)(F)F)C(C(O)=O)=C1)C2CCCCN2
Synonyms:
  • 1-(2-Piperidinylmethyl)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid
  • 1H-Pyrrole-3-carboxylic acid, 1-(2-piperidinylmethyl)-4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.