CAS 1240526-74-2

N-[(1,2-Dimethyl-1H-imidazol-4-yl)sulfonyl]-β-alanine

Description:

N-[(1,2-Dimethyl-1H-imidazol-4-yl)sulfonyl]-β-alanine is a chemical compound characterized by its unique structure, which includes a β-alanine moiety linked to a sulfonyl group that is further connected to a 1,2-dimethyl-1H-imidazole ring. This compound exhibits properties typical of sulfonamides, including potential biological activity due to the presence of the imidazole ring, which is known for its role in various biochemical processes. The sulfonyl group contributes to the compound's polarity and solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. Additionally, the presence of the β-alanine component may influence its interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's structural features suggest it may have interesting properties for further investigation in pharmaceutical research, particularly in the context of developing new therapeutic agents.

Formula: C₈H₁₃N₃O₄S

InChI: InChI=1S/C8H13N3O4S/c1-6-10-7(5-11(6)2)16(14,15)9-4-3-8(12)13/h5,9H,3-4H2,1-2H3,(H,12,13)

InChI key: InChIKey=OQKWFFHPGWAWHW-UHFFFAOYSA-N

SMILES: S(NCCC(O)=O)(=O)(=O)C1=CN(C)C(C)=N1

Synonyms:

• β-Alanine, N-[(1,2-dimethyl-1H-imidazol-4-yl)sulfonyl]-
• N-[(1,2-Dimethyl-1H-imidazol-4-yl)sulfonyl]-β-alanine

3-(1,2-Dimethyl-1H-imidazole-4-sulfonamido)propanoic acid

CAS: 1240526-74-2

Versatile small molecule scaffold

Formula: C₈H₁₃N₃O₄S

Purity: Min. 95%

Molecular weight: 247.27 g/mol

Ref: 3D-QZB52674