CAS 1240527-08-5

N-[(1,3-Dihydro-5-isobenzofuranyl)sulfonyl]glycine

Description:

N-[(1,3-Dihydro-5-isobenzofuranyl)sulfonyl]glycine, identified by its CAS number 1240527-08-5, is a chemical compound characterized by its unique structural features, which include a sulfonyl group attached to a glycine moiety and a bicyclic isobenzofuran structure. This compound is likely to exhibit properties typical of sulfonamides, such as potential biological activity, including antimicrobial or anti-inflammatory effects, due to the presence of the sulfonyl functional group. The bicyclic isobenzofuran component may contribute to its lipophilicity and ability to interact with biological targets. In terms of solubility, compounds of this nature often display moderate solubility in organic solvents, while their solubility in water can vary based on the specific substituents and overall molecular structure. The compound's stability, reactivity, and potential applications in pharmaceuticals or agrochemicals would depend on its specific interactions with biological systems and environmental conditions. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₀H₁₁NO₅S

InChI: InChI=1S/C10H11NO5S/c12-10(13)4-11-17(14,15)9-2-1-7-5-16-6-8(7)3-9/h1-3,11H,4-6H2,(H,12,13)

InChI key: InChIKey=HSFRMYSRFFROKC-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C=1C=C2C(=CC1)COC2

Synonyms:

• Glycine, N-[(1,3-dihydro-5-isobenzofuranyl)sulfonyl]-
• N-[(1,3-Dihydro-5-isobenzofuranyl)sulfonyl]glycine

2-(1,3-Dihydro-2-benzofuran-5-sulfonamido)acetic acid

CAS: 1240527-08-5

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO₅S

Purity: Min. 95%

Molecular weight: 257.27 g/mol

Ref: 3D-QZB52708