CAS 1240527-11-0

Piperidine, 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-chlorophenyl group and a 1,2,4-oxadiazole moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the oxadiazole ring suggests potential for various biological interactions, making it of interest in medicinal chemistry. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic effects, although specific biological activities would require empirical investigation. Its molecular structure and functional groups can influence its reactivity, stability, and interaction with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₃H₁₄ClN₃O·ClH

InChI: InChI=1S/C13H14ClN3O.ClH/c14-11-5-3-9(4-6-11)12-16-13(18-17-12)10-2-1-7-15-8-10;/h3-6,10,15H,1-2,7-8H2;1H

InChI key: InChIKey=KACPCEIDAYYWTL-UHFFFAOYSA-N

SMILES: ClC1=CC=C(C=2N=C(ON2)C3CCCNC3)C=C1.Cl

Synonyms:

• Piperidine, 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

3-[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidine hydrochloride

CAS: 1240527-11-0

Versatile small molecule scaffold

Formula: C₁₃H₁₅Cl₂N₃O

Purity: Min. 95%

Molecular weight: 300.18 g/mol

Ref: 3D-QZB52711