
CAS 1240527-12-1
:4-[3-(3-Fluorophenyl)propyl]benzenamine
Description:
4-[3-(3-Fluorophenyl)propyl]benzenamine, identified by its CAS number 1240527-12-1, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with an amine group and a propyl chain that is further substituted with a fluorophenyl group. This compound is likely to exhibit properties typical of aromatic amines, such as being a solid at room temperature and having moderate solubility in organic solvents. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. Additionally, the compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or development. Safety considerations should be taken into account, as many aromatic amines can be toxic or carcinogenic. Overall, 4-[3-(3-Fluorophenyl)propyl]benzenamine represents a compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C15H16FN
InChI:InChI=1S/C15H16FN/c16-14-6-2-5-13(11-14)4-1-3-12-7-9-15(17)10-8-12/h2,5-11H,1,3-4,17H2
InChI key:InChIKey=NTYVBOYPIIAFRR-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(N)C=C1)C2=CC(F)=CC=C2
Synonyms:- 4-[3-(3-Fluorophenyl)propyl]benzenamine
- Benzenamine, 4-[3-(3-fluorophenyl)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.