CAS 1240527-15-4

Cyclohexanol, 4-[[(3-methoxyphenyl)methyl]amino]-, hydrochloride (1:1)

Description:

Cyclohexanol, 4-[[[3-methoxyphenyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its cyclohexanol backbone, which is a six-membered saturated ring containing a hydroxyl group. The presence of a 3-methoxyphenyl group indicates that there is a methoxy substituent on a phenyl ring, contributing to its aromatic properties. The compound features an amino group, which suggests potential basicity and the ability to form salts, as indicated by its hydrochloride form. This hydrochloride salt form enhances its solubility in water, making it more bioavailable for various applications. The molecular structure implies potential interactions with biological systems, which may be relevant in pharmacological contexts. Cyclohexanol derivatives are often studied for their solvent properties and as intermediates in organic synthesis. Overall, this compound's unique structure and functional groups suggest it may exhibit interesting chemical reactivity and biological activity, warranting further investigation in medicinal chemistry and related fields.

Formula: C₁₄H₂₁NO₂·ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-17-14-4-2-3-11(9-14)10-15-12-5-7-13(16)8-6-12;/h2-4,9,12-13,15-16H,5-8,10H2,1H3;1H

InChI key: InChIKey=CLHDTQAWTIDOMU-UHFFFAOYSA-N

SMILES: C(NC1CCC(O)CC1)C2=CC(OC)=CC=C2.Cl

Synonyms:

• Cyclohexanol, 4-[[(3-methoxyphenyl)methyl]amino]-, hydrochloride (1:1)

4-{[(3-Methoxyphenyl)methyl]amino}cyclohexan-1-ol hydrochloride

CAS: 1240527-15-4

Versatile small molecule scaffold

Formula: C₁₄H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 271.78 g/mol

Ref: 3D-QZB52715