CAS 1240527-26-7

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-cyclopropylethyl)-, hydrochloride (1:1)

Description:

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-cyclopropylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique triazole and pyridine ring structure, which contributes to its potential biological activity. The presence of the cyclopropyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various biological activities, including potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its molecular structure suggests that it could interact with specific receptors or enzymes, although detailed studies would be necessary to elucidate its mechanism of action. Safety and toxicity profiles would also need to be established through rigorous testing. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development due to their diverse biological activities and structural complexity.

Formula: C₁₂H₁₆N₄·ClH

InChI: InChI=1S/C12H16N4.ClH/c1-9(10-5-6-10)13-8-12-15-14-11-4-2-3-7-16(11)12;/h2-4,7,9-10,13H,5-6,8H2,1H3;1H

InChI key: InChIKey=QTSUJMBFEMHWAB-UHFFFAOYSA-N

SMILES: C(NC(C)C1CC1)C=2N3C(=NN2)C=CC=C3.Cl

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-cyclopropylethyl)-, hydrochloride (1:1)