CAS 1240527-29-0

Acetamide, 2-amino-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-, hydrochloride (1:2)

Description:

Acetamide, 2-amino-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group and the presence of a triazole moiety, which contributes to its potential biological activity. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The triazole ring is known for its role in various pharmacological applications, including antifungal and antimicrobial properties. The compound's structure suggests it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the amino group enhances its reactivity and potential for forming hydrogen bonds, which can influence its solubility and interaction with biological systems. As with many compounds containing nitrogen heterocycles, it may exhibit unique properties such as stability under certain conditions and specific reactivity patterns, which are important for its application in research and development.

Formula: C₁₀H₁₁N₅O·2ClH

InChI: InChI=1S/C10H11N5O.2ClH/c11-5-10(16)14-8-1-3-9(4-2-8)15-7-12-6-13-15;;/h1-4,6-7H,5,11H2,(H,14,16);2*1H

InChI key: InChIKey=PPFVRXSAGPCFQE-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C1=CC=C(C=C1)N2C=NC=N2.Cl

Synonyms:

• Acetamide, 2-amino-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]-, hydrochloride (1:2)

2-Amino-N-[4-(1H-1,2,4-triazol-1-yl)phenyl]acetamide dihydrochloride

CAS: 1240527-29-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃Cl₂N₅O

Purity: Min. 95%

Molecular weight: 290.15 g/mol

Ref: 3D-QZB52729