CAS 1240527-32-5

Benzenamine, 3-fluoro-4-methoxy-N-(1-methylethyl)-, hydrochloride (1:1)

Description:

Benzenamine, 3-fluoro-4-methoxy-N-(1-methylethyl)-, hydrochloride (1:1), also known by its CAS number 1240527-32-5, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a fluorine atom at the 3-position and a methoxy group at the 4-position. The presence of the N-(1-methylethyl) group indicates that it has an isopropyl substituent attached to the nitrogen atom, contributing to its overall hydrophobic character. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity due to its amine functionality, potentially interacting with biological targets. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₄FNO·ClH

InChI: InChI=1S/C10H14FNO.ClH/c1-7(2)12-8-4-5-10(13-3)9(11)6-8;/h4-7,12H,1-3H3;1H

InChI key: InChIKey=FSZTVQUEOZJFOH-UHFFFAOYSA-N

SMILES: O(C)C1=C(F)C=C(NC(C)C)C=C1.Cl

Synonyms:

• Benzenamine, 3-fluoro-4-methoxy-N-(1-methylethyl)-, hydrochloride (1:1)

3-Fluoro-4-methoxy-N-(propan-2-yl)aniline hydrochloride

CAS: 1240527-32-5

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 219.68 g/mol

Ref: 3D-QZB52732