CAS 1240527-35-8

Benzenamine, 2,6-difluoro-4-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenamine, 2,6-difluoro-4-(trifluoromethyl)-, hydrochloride (1:1), also known by its CAS number 1240527-35-8, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two fluorine atoms at the 2 and 6 positions, and a trifluoromethyl group at the 4 position. The presence of these fluorine substituents significantly influences its chemical properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis and handling require careful consideration due to the reactivity of fluorinated compounds and the potential for environmental impact. Overall, 2,6-difluoro-4-(trifluoromethyl)benzenamine hydrochloride represents a unique class of fluorinated aromatic amines with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₄F₅N·ClH

InChI: InChI=1S/C7H4F5N.ClH/c8-4-1-3(7(10,11)12)2-5(9)6(4)13;/h1-2H,13H2;1H

InChI key: InChIKey=NCGLNXRCRZSFRI-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(F)=C(N)C(F)=C1.Cl

Synonyms:

• Benzenamine, 2,6-difluoro-4-(trifluoromethyl)-, hydrochloride (1:1)