CAS 1240527-40-5

Ethanone, 2-amino-1-[4-(3-chlorophenyl)-1-piperazinyl]-, hydrochloride (1:2)

Description:

Ethanone, 2-amino-1-[4-(3-chlorophenyl)-1-piperazinyl]-, hydrochloride (1:2), commonly referred to as a piperazine derivative, is a chemical compound characterized by its structural features that include an ethanone moiety and a piperazine ring substituted with a 3-chlorophenyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and bioavailability. The presence of the amino group contributes to its potential as a pharmacological agent, often investigated for its effects on the central nervous system. Its molecular structure suggests it may interact with various neurotransmitter systems, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. As with any compound, thorough characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and application contexts.

Formula: C₁₂H₁₆ClN₃O·2ClH

InChI: InChI=1S/C12H16ClN3O.2ClH/c13-10-2-1-3-11(8-10)15-4-6-16(7-5-15)12(17)9-14;;/h1-3,8H,4-7,9,14H2;2*1H

InChI key: InChIKey=GJWMZWVVMMVZDO-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1)N2CCN(C(CN)=O)CC2.Cl

Synonyms:

• Ethanone, 2-amino-1-[4-(3-chlorophenyl)-1-piperazinyl]-, hydrochloride (1:2)

2-Amino-1-[4-(3-chlorophenyl)piperazin-1-yl]ethan-1-one dihydrochloride

Controlled Product

CAS: 1240527-40-5

Versatile small molecule scaffold

Formula: C₁₂H₁₈Cl₃N₃O

Purity: Min. 95%

Molecular weight: 326.6 g/mol

Ref: 3D-QZB52740