CAS 1240527-41-6

4-Methyl-3-(1-methylethyl)-4H-1,2,4-triazole

Description:

4-Methyl-3-(1-methylethyl)-4H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a methyl group and an isopropyl group, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the triazole moiety suggests potential applications in agricultural chemistry, particularly as a fungicide or herbicide, due to its ability to inhibit specific biological pathways in target organisms. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary based on environmental conditions, such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Methyl-3-(1-methylethyl)-4H-1,2,4-triazole represents a versatile compound with potential applications in various fields.

Formula: C₆H₁₁N₃

InChI: InChI=1S/C6H11N3/c1-5(2)6-8-7-4-9(6)3/h4-5H,1-3H3

InChI key: InChIKey=NEEHZOMPACKFRR-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N(C)C=NN1

Synonyms:

• 4H-1,2,4-Triazole, 4-methyl-3-(1-methylethyl)-
• 4-Methyl-3-(1-methylethyl)-4H-1,2,4-triazole

4-Methyl-3-(propan-2-yl)-4H-1,2,4-triazole

CAS: 1240527-41-6

Versatile small molecule scaffold

Formula: C₆H₁₁N₃

Purity: Min. 95%

Molecular weight: 125.17 g/mol

Ref: 3D-QZB52741