CAS 1240527-45-0

Imidazo[1,2-a]pyridine, 6-chloro-2-(1-piperazinylmethyl)-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine, 6-chloro-2-(1-piperazinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine core structure, which is a bicyclic compound featuring both imidazole and pyridine rings. The presence of a chlorine atom at the 6-position of the imidazo ring contributes to its reactivity and potential biological activity. The piperazinylmethyl substituent at the 2-position enhances its solubility and may influence its pharmacological properties, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in various applications, including drug formulation. The compound may exhibit a range of biological activities, potentially acting as a ligand for various receptors or enzymes. Its specific interactions and effects would depend on the context of its use, including concentration and the biological system involved. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and pharmaceutical contexts.

Formula: C₁₂H₁₅ClN₄·ClH

InChI: InChI=1S/C12H15ClN4.ClH/c13-10-1-2-12-15-11(9-17(12)7-10)8-16-5-3-14-4-6-16;/h1-2,7,9,14H,3-6,8H2;1H

InChI key: InChIKey=RVXFCWFHRASCOH-UHFFFAOYSA-N

SMILES: C(C=1N=C2N(C1)C=C(Cl)C=C2)N3CCNCC3.Cl

Synonyms:

• Imidazo[1,2-a]pyridine, 6-chloro-2-(1-piperazinylmethyl)-, hydrochloride (1:1)

1-({6-Chloroimidazo[1,2-a]pyridin-2-yl}methyl)piperazine hydrochloride

CAS: 1240527-45-0

Versatile small molecule scaffold

Formula: C₁₂H₁₆Cl₂N₄

Purity: Min. 95%

Molecular weight: 287.19 g/mol

Ref: 3D-QZB52745