CymitQuimica logo

CAS 1240527-63-2

:

1H-Imidazol-2-amine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:
1H-Imidazol-2-amine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which contributes to its potential biological activity. The presence of the 2-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. This compound may exhibit properties such as being a potential pharmacophore in drug discovery, particularly in the development of agents targeting specific receptors or enzymes. Its molecular structure suggests it could participate in hydrogen bonding and other interactions due to the presence of nitrogen atoms in the imidazole ring. The compound's characteristics, including its stability, reactivity, and biological activity, would be influenced by the specific functional groups present and their spatial arrangement. Further studies would be necessary to elucidate its full pharmacological profile and potential applications in medicinal chemistry.
Formula:C10H10FN3·ClH
InChI:InChI=1S/C10H10FN3.ClH/c11-9-4-2-1-3-8(9)7-14-6-5-13-10(14)12;/h1-6H,7H2,(H2,12,13);1H
InChI key:InChIKey=UINPEBATCZIUKZ-UHFFFAOYSA-N
SMILES:C(N1C(N)=NC=C1)C2=C(F)C=CC=C2.Cl
Synonyms:
  • 1H-Imidazol-2-amine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.