CymitQuimica logo

CAS 1240527-67-6

:

2-[(Difluoromethyl)sulfonyl]phenol

Description:
2-[(Difluoromethyl)sulfonyl]phenol is an organic compound characterized by the presence of a phenolic group and a difluoromethylsulfonyl functional group. This compound typically exhibits properties associated with both aromatic compounds and sulfonyl derivatives. The difluoromethyl group introduces significant electronegativity, which can influence the compound's reactivity and polarity. The sulfonyl moiety contributes to its potential as a strong electrophile, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the hydroxyl group (from the phenol) can enhance hydrogen bonding capabilities, affecting solubility and interaction with other molecules. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-[(Difluoromethyl)sulfonyl]phenol is a versatile compound with applications in organic synthesis and potentially in medicinal chemistry.
Formula:C7H6F2O3S
InChI:InChI=1S/C7H6F2O3S/c8-7(9)13(11,12)6-4-2-1-3-5(6)10/h1-4,7,10H
InChI key:InChIKey=LGBOBVQWICIRGJ-UHFFFAOYSA-N
SMILES:S(C(F)F)(=O)(=O)C1=C(O)C=CC=C1
Synonyms:
  • Phenol, 2-[(difluoromethyl)sulfonyl]-
  • 2-[(Difluoromethyl)sulfonyl]phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.