CAS 1240527-69-8

Glycine, N-(cyclopropylmethyl)-, methyl ester, hydrochloride (1:1)

Description:

Glycine, N-(cyclopropylmethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a glycine backbone modified with a cyclopropylmethyl group and a methyl ester functional group. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and biochemistry. The presence of the cyclopropylmethyl group may impart unique steric and electronic properties, potentially influencing its biological activity and interactions with receptors or enzymes. This compound is likely to exhibit characteristics typical of amino acid derivatives, such as being a zwitterion at physiological pH, which can affect its solubility and reactivity. Additionally, the methyl ester functionality suggests potential for hydrolysis to release glycine, which may be relevant in metabolic pathways. Overall, this compound's unique structural features may contribute to its specific applications in medicinal chemistry and research.

Formula: C₇H₁₃NO₂·ClH

InChI: InChI=1S/C7H13NO2.ClH/c1-10-7(9)5-8-4-6-2-3-6;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=NIYOHPIJDHJQIO-UHFFFAOYSA-N

SMILES: C(NCC(OC)=O)C1CC1.Cl

Synonyms:

• Glycine, N-(cyclopropylmethyl)-, methyl ester, hydrochloride (1:1)

Methyl 2-[(cyclopropylmethyl)amino]acetate hydrochloride

CAS: 1240527-69-8

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 179.64 g/mol

Ref: 3D-QZB52769