CAS 1240527-78-9

1H-1,2,4-Triazole-5-methanamine, 3-(4-bromophenyl)-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-5-methanamine, 3-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methanamine group and a 4-bromophenyl substituent, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly as antifungal or antimicrobial agents, due to the presence of the triazole moiety. The presence of the bromine atom can also affect the compound's reactivity and biological interactions. As with many triazole derivatives, this compound may exhibit a range of biological activities, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological effects.

Formula: C₉H₉BrN₄·ClH

InChI: InChI=1S/C9H9BrN4.ClH/c10-7-3-1-6(2-4-7)9-12-8(5-11)13-14-9;/h1-4H,5,11H2,(H,12,13,14);1H

InChI key: InChIKey=NGCSVHKYOODXAM-UHFFFAOYSA-N

SMILES: C(N)C=1NC(=NN1)C2=CC=C(Br)C=C2.Cl

Synonyms:

• 1H-1,2,4-Triazole-5-methanamine, 3-(4-bromophenyl)-, hydrochloride (1:1)

[3-(4-Bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine hydrochloride

CAS: 1240527-78-9

Versatile small molecule scaffold

Formula: C₉H₁₀BrClN₄

Purity: Min. 95%

Molecular weight: 289.56 g/mol

Ref: 3D-QZB52778