
CAS 1240527-81-4
:3-Ethyl-3-azabicyclo[3.1.1]heptan-6-amine
Description:
3-Ethyl-3-azabicyclo[3.1.1]heptan-6-amine is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring containing a nitrogen atom. The presence of the ethyl group at the 3-position contributes to its steric and electronic properties, influencing its reactivity and potential interactions with biological systems. The nitrogen atom in the bicyclic framework classifies it as a bicyclic amine, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound may exhibit basic properties due to the amine functional group, allowing it to interact with acids to form salts. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Additionally, the compound's stereochemistry and conformation can significantly affect its biological activity and pharmacokinetics. Overall, 3-Ethyl-3-azabicyclo[3.1.1]heptan-6-amine represents a fascinating subject for further research in organic synthesis and drug design.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c1-2-10-4-6-3-7(5-10)8(6)9/h6-8H,2-5,9H2,1H3
InChI key:InChIKey=XXPXFCKDCSUTOC-UHFFFAOYSA-N
SMILES:NC1C2CC1CN(CC)C2
Synonyms:- 3-Azabicyclo[3.1.1]heptan-6-amine, 3-ethyl-
- 3-Ethyl-3-azabicyclo[3.1.1]heptan-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.