CAS 1240527-84-7

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-methylbutyl)-, hydrochloride (1:2)

Description:

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-methylbutyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole and pyridine moieties, which contribute to its potential biological activity. The presence of the triazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to form hydrogen bonds and participate in various chemical reactions. The N-(1-methylbutyl) substituent enhances lipophilicity, potentially improving the compound's membrane permeability and bioavailability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in aqueous environments. The compound's molecular structure may exhibit specific pharmacological properties, making it of interest in research related to neuropharmacology or other therapeutic areas. However, detailed studies on its toxicity, efficacy, and mechanism of action would be necessary to fully understand its potential applications and safety profile.

Formula: C₁₂H₁₈N₄·2ClH

InChI: InChI=1S/C12H18N4.2ClH/c1-3-6-10(2)13-9-12-15-14-11-7-4-5-8-16(11)12;;/h4-5,7-8,10,13H,3,6,9H2,1-2H3;2*1H

InChI key: InChIKey=BPYAAPLRRDPMQR-UHFFFAOYSA-N

SMILES: C(NC(CCC)C)C=1N2C(=NN1)C=CC=C2.Cl

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-methylbutyl)-, hydrochloride (1:2)