
CAS 1240528-04-4
:Description:
The chemical substance with the CAS number 1240528-04-4 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds are characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. The characteristics of a chemical substance can also include its appearance (solid, liquid, or gas), odor, and potential hazards associated with its use. Additionally, the compound may have specific applications in various fields such as pharmaceuticals, materials science, or industrial processes. To obtain precise information about this particular compound, including its safety data, synthesis methods, and potential uses, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive details on the substance in question.
Formula:C7H12O5S
InChI:InChI=1S/C7H12O5S/c1-13(10,11)4-5-2-3-6(12-5)7(8)9/h5-6H,2-4H2,1H3,(H,8,9)
InChI key:InChIKey=PDPDZOOAVRIGCC-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)C1OC(C(O)=O)CC1
Synonyms:- 5-(Methylsulfonylmethyl)oxolane-2-carboxylic acid
- 5-(Methanesulfonylmethyl)oxolane-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.