CAS 1240528-06-6

3,4-Dihydro-2,3-dioxo-1(2H)-pyrazinepropanoic acid

Description:

3,4-Dihydro-2,3-dioxo-1(2H)-pyrazinepropanoic acid is a heterocyclic organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a propanoic acid moiety, contributing to its acidic properties. The presence of two carbonyl groups (dioxo) indicates that it has significant reactivity, particularly in forming hydrogen bonds and participating in various chemical reactions, such as nucleophilic additions. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, where such heterocycles are often explored for their biological activity. The compound's solubility and stability can vary depending on the pH and solvent conditions, which are important factors for its practical applications. Additionally, the presence of the dioxo functional groups may enhance its ability to interact with biological targets, making it a candidate for further research in medicinal chemistry. Overall, 3,4-Dihydro-2,3-dioxo-1(2H)-pyrazinepropanoic acid exhibits unique chemical properties that warrant investigation for potential uses in various fields.

Formula: C₇H₈N₂O₄

InChI: InChI=1S/C7H8N2O4/c10-5(11)1-3-9-4-2-8-6(12)7(9)13/h2,4H,1,3H2,(H,8,12)(H,10,11)

InChI key: InChIKey=HOTUXCYCSCDRGV-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C(=O)C(=O)NC=C1

Synonyms:

• 3,4-Dihydro-2,3-dioxo-1(2H)-pyrazinepropanoic acid
• 1(2H)-Pyrazinepropanoic acid, 3,4-dihydro-2,3-dioxo-

3-(2,3-Dioxo-1,2,3,4-tetrahydropyrazin-1-yl)propanoic acid

CAS: 1240528-06-6

Versatile small molecule scaffold

Formula: C₇H₈N₂O₄

Purity: Min. 95%

Molecular weight: 184.15 g/mol

Ref: 3D-QZB52806