CAS 1240528-15-7

Cycloheptanamine, 1-(4-methoxyphenyl)-, hydrochloride (1:1)

Description:

Cycloheptanamine, 1-(4-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclic amine structure, which includes a seven-membered cycloheptane ring. The presence of a 4-methoxyphenyl group indicates that there is a methoxy substituent on a phenyl ring, contributing to its aromatic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity due to its amine functionality, which can interact with biological receptors. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in research or therapeutic contexts.

Formula: C₁₄H₂₁NO·ClH

InChI: InChI=1S/C14H21NO.ClH/c1-16-13-8-6-12(7-9-13)14(15)10-4-2-3-5-11-14;/h6-9H,2-5,10-11,15H2,1H3;1H

InChI key: InChIKey=SWXURBIMVIQUDW-UHFFFAOYSA-N

SMILES: NC1(CCCCCC1)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Cycloheptanamine, 1-(4-methoxyphenyl)-, hydrochloride (1:1)

1-(4-Methoxyphenyl)cycloheptan-1-amine hydrochloride

CAS: 1240528-15-7

Versatile small molecule scaffold

Formula: C₁₄H₂₂ClNO

Purity: Min. 95%

Molecular weight: 255.78 g/mol

Ref: 3D-QZB52815