CAS 1240528-21-5

Carbamic acid, N-3-pyridinyl-, 2-chloroethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-3-pyridinyl-, 2-chloroethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a pyridine ring and a chloroethyl ester functional group. This compound is typically classified as a carbamate, which is known for its applications in pharmaceuticals and agrochemicals. The presence of the pyridine moiety often contributes to its biological activity, potentially influencing its interaction with various biological targets. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in aqueous environments, which is advantageous for biological assays and formulations. The chloroethyl group may impart specific reactivity, making it a candidate for further chemical modifications or as a precursor in synthetic pathways. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, although specific biological activities and toxicological profiles would require further investigation to fully understand its implications in practical applications.

Formula: C₈H₉ClN₂O₂·ClH

InChI: InChI=1S/C8H9ClN2O2.ClH/c9-3-5-13-8(12)11-7-2-1-4-10-6-7;/h1-2,4,6H,3,5H2,(H,11,12);1H

InChI key: InChIKey=KBZKLUBISLIOEJ-UHFFFAOYSA-N

SMILES: N(C(OCCCl)=O)C=1C=CC=NC1.Cl

Synonyms:

• 2-Chloroethyl N-(pyridin-3-yl)carbamate hydrochloride
• Carbamic acid, N-3-pyridinyl-, 2-chloroethyl ester, hydrochloride (1:1)

2-Chloroethyl N-(pyridin-3-yl)carbamate hydrochloride

CAS: 1240528-21-5

Versatile small molecule scaffold

Formula: C₈H₁₀Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 237.08 g/mol

Ref: 3D-QZB52821