
CAS 1240528-24-8
:4-Chloro-2-methyl-6-(trifluoromethyl)benzenamine
Description:
4-Chloro-2-methyl-6-(trifluoromethyl)benzenamine, with the CAS number 1240528-24-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a methyl group, and a trifluoromethyl group, along with an amino group. This compound is typically a solid at room temperature and exhibits properties common to aromatic amines, such as potential reactivity in electrophilic substitution reactions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the chlorine and trifluoromethyl substituents can impart unique electronic properties, affecting the compound's reactivity and stability. Safety considerations are important, as many chlorinated and fluorinated compounds can pose environmental and health risks. Overall, 4-Chloro-2-methyl-6-(trifluoromethyl)benzenamine is a compound of interest in various chemical applications, particularly in the development of new materials and pharmaceuticals.
Formula:C8H7ClF3N
InChI:InChI=1S/C8H7ClF3N/c1-4-2-5(9)3-6(7(4)13)8(10,11)12/h2-3H,13H2,1H3
InChI key:InChIKey=MDEUAVQNTUEOTB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N)C(C)=CC(Cl)=C1
Synonyms:- 4-Chloro-2-methyl-6-(trifluoromethyl)benzenamine
- 4-Chloro-2-methyl-6-(trifluoromethyl)aniline
- Benzenamine, 4-chloro-2-methyl-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.