CAS 1240528-27-1

Benzenemethanamine, 4-methoxy-3-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-methoxy-3-(2-propyn-1-yloxy)-, hydrochloride (1:1), with the CAS number 1240528-27-1, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a methoxy group and a propynyl ether. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential solubility in organic solvents and moderate polarity. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility in aqueous solutions. The specific functional groups present suggest potential reactivity, particularly in nucleophilic substitution reactions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. However, detailed information regarding its toxicity, pharmacokinetics, and specific applications would require further investigation and analysis. As with any chemical substance, appropriate safety measures should be taken when handling it in laboratory or industrial settings.

Formula: C₁₁H₁₃NO₂·ClH

InChI: InChI=1S/C11H13NO2.ClH/c1-3-6-14-11-7-9(8-12)4-5-10(11)13-2;/h1,4-5,7H,6,8,12H2,2H3;1H

InChI key: InChIKey=AJZHQIDIJGTKKX-UHFFFAOYSA-N

SMILES: O(CC#C)C1=C(OC)C=CC(CN)=C1.Cl

Synonyms:

• Benzenemethanamine, 4-methoxy-3-(2-propyn-1-yloxy)-, hydrochloride (1:1)

[4-Methoxy-3-(prop-2-yn-1-yloxy)phenyl]methanamine hydrochloride

CAS: 1240528-27-1

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-QZB52827