CymitQuimica logo

CAS 1240528-30-6

:

Phenol, 2-amino-4-[(hexahydro-1H-azepin-1-yl)methyl]-, hydrobromide (1:2)

Description:
Phenol, 2-amino-4-[(hexahydro-1H-azepin-1-yl)methyl]-, hydrobromide (1:2) is a chemical compound characterized by its phenolic structure, which includes an amino group and a hexahydro-1H-azepin moiety. The presence of the amino group suggests potential basicity and reactivity in various chemical reactions, while the phenolic hydroxyl group can participate in hydrogen bonding and contribute to the compound's solubility in polar solvents. The hydrobromide salt form indicates that the compound is protonated, enhancing its stability and solubility in aqueous environments. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Additionally, the hexahydro-1H-azepin ring contributes to the compound's overall three-dimensional conformation, potentially influencing its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural elements may lead to diverse applications in pharmaceuticals or agrochemicals, although specific properties such as melting point, boiling point, and reactivity would require empirical determination.
Formula:C13H20N2O·2BrH
InChI:InChI=1S/C13H20N2O.2BrH/c14-12-9-11(5-6-13(12)16)10-15-7-3-1-2-4-8-15;;/h5-6,9,16H,1-4,7-8,10,14H2;2*1H
InChI key:InChIKey=PLZTUKZCJAXJKG-UHFFFAOYSA-N
SMILES:C(C1=CC(N)=C(O)C=C1)N2CCCCCC2.Br
Synonyms:
  • Phenol, 2-amino-4-[(hexahydro-1H-azepin-1-yl)methyl]-, hydrobromide (1:2)
Found 1 products.