CAS 1240528-53-3

2-Benzothiazolemethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)

Description:

2-Benzothiazolemethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety and a tetrahydro group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The benzothiazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The tetrahydro component suggests that it may exhibit specific stereochemical properties, influencing its interactions with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may be utilized in various applications, including drug development, where its pharmacological properties can be explored. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₁₂N₂S·2ClH

InChI: InChI=1S/C8H12N2S.2ClH/c9-5-8-10-6-3-1-2-4-7(6)11-8;;/h1-5,9H2;2*1H

InChI key: InChIKey=LTLFMUVSNFZYSM-UHFFFAOYSA-N

SMILES: C(N)C1=NC2=C(S1)CCCC2.Cl

Synonyms:

• 2-Benzothiazolemethanamine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)

4,5,6,7-Tetrahydro-1,3-benzothiazol-2-ylmethanamine dihydrochloride

CAS: 1240528-53-3

Versatile small molecule scaffold

Formula: C₈H₁₄Cl₂N₂S

Purity: Min. 95%

Molecular weight: 241.18 g/mol

Ref: 3D-QZB52853