CAS 1240528-55-5

Acetamide, 2-amino-N-methyl-N-(3-pyridinylmethyl)-, hydrochloride (1:2)

Description:

Acetamide, 2-amino-N-methyl-N-(3-pyridinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a pyridine ring, indicating its potential for aromatic interactions and biological activity. The presence of the amino group suggests it can participate in hydrogen bonding, enhancing its solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular structure allows for various interactions with biological macromolecules, which could influence its efficacy and mechanism of action. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or therapeutic contexts.

Formula: C₉H₁₃N₃O·2ClH

InChI: InChI=1S/C9H13N3O.2ClH/c1-12(9(13)5-10)7-8-3-2-4-11-6-8;;/h2-4,6H,5,7,10H2,1H3;2*1H

InChI key: InChIKey=PFUFDFDWAIHNRF-UHFFFAOYSA-N

SMILES: C(N(C(CN)=O)C)C=1C=CC=NC1.Cl

Synonyms:

• Acetamide, 2-amino-N-methyl-N-(3-pyridinylmethyl)-, hydrochloride (1:2)

2-Amino-N-methyl-N-(pyridin-3-ylmethyl)acetamide dihydrochloride

CAS: 1240528-55-5

Versatile small molecule scaffold

Formula: C₉H₁₅Cl₂N₃O

Purity: Min. 95%

Molecular weight: 252.14 g/mol

Ref: 3D-QZB52855