CAS 1240528-60-2

6-Chloro-1-(1,1-dimethylethyl)-4,7-dihydro-1H-pyrazolo[3,4-d]pyrimidine

Description:

6-Chloro-1-(1,1-dimethylethyl)-4,7-dihydro-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. The presence of a chlorine atom at the 6-position and a tert-butyl group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. The compound may also demonstrate specific reactivity patterns due to the presence of the chlorine substituent, which can influence its interaction with biological targets. Additionally, the presence of the bulky tert-butyl group may affect its steric properties and overall reactivity. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the reaction conditions.

Formula: C₉H₁₃ClN₄

InChI: InChI=1S/C9H13ClN4/c1-9(2,3)14-7-6(5-12-14)4-11-8(10)13-7/h5H,4H2,1-3H3,(H,11,13)

InChI key: InChIKey=XRAYTMYJALHNQU-UHFFFAOYSA-N

SMILES: C(C)(C)(C)N1C2=C(C=N1)CN=C(Cl)N2

Synonyms:

• 6-Chloro-1-(1,1-dimethylethyl)-4,7-dihydro-1H-pyrazolo[3,4-d]pyrimidine
• 1H-Pyrazolo[3,4-d]pyrimidine, 6-chloro-1-(1,1-dimethylethyl)-4,7-dihydro-