CAS 1240528-66-8

1H-Benzotriazole, 4,5,6,7-tetrahydro-1-(4-piperidinyl)-, hydrochloride (1:2)

Description:

1H-Benzotriazole, 4,5,6,7-tetrahydro-1-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its benzotriazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and a piperidine moiety, which contributes to its basicity and potential biological activity. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceuticals and agrochemicals. The presence of the piperidine group may impart psychoactive properties, while the benzotriazole component is often associated with UV-absorbing properties, making it useful in protective coatings and stabilizers. Overall, this compound's unique structure and functional groups suggest potential utility in diverse fields, including medicinal chemistry and materials science. However, specific applications and safety profiles would require further investigation and data.

Formula: C₁₁H₁₈N₄·2ClH

InChI: InChI=1S/C11H18N4.2ClH/c1-2-4-11-10(3-1)13-14-15(11)9-5-7-12-8-6-9;;/h9,12H,1-8H2;2*1H

InChI key: InChIKey=NHWJSOHDBISKEI-UHFFFAOYSA-N

SMILES: N1(C2=C(N=N1)CCCC2)C3CCNCC3.Cl

Synonyms:

• 1H-Benzotriazole, 4,5,6,7-tetrahydro-1-(4-piperidinyl)-, hydrochloride (1:2)

1-(Piperidin-4-yl)-4,5,6,7-tetrahydro-1H-1,2,3-benzotriazole dihydrochloride

CAS: 1240528-66-8

Versatile small molecule scaffold

Formula: C₁₁H₂₀Cl₂N₄

Purity: Min. 95%

Molecular weight: 279.21 g/mol

Ref: 3D-QZB52866