CAS 1240528-69-1

3-Thiophenamine, tetrahydro-4-(1-pyrrolidinyl)-, 1,1-dioxide, hydrochloride (1:2)

Description:

3-Thiophenamine, tetrahydro-4-(1-pyrrolidinyl)-, 1,1-dioxide, hydrochloride (1:2) is a chemical compound characterized by its unique structure that includes a thiophene ring and a pyrrolidine moiety. The presence of the 1,1-dioxide functional group indicates that the compound has two oxygen atoms double-bonded to a sulfur atom, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological effects, although specific biological activities would depend on further studies. Its molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₈H₁₆N₂O₂S·2ClH

InChI: InChI=1S/C8H16N2O2S.2ClH/c9-7-5-13(11,12)6-8(7)10-3-1-2-4-10;;/h7-8H,1-6,9H2;2*1H

InChI key: InChIKey=HLMRGMUIIASRRV-UHFFFAOYSA-N

SMILES: NC1C(CS(=O)(=O)C1)N2CCCC2.Cl

Synonyms:

• 3-Thiophenamine, tetrahydro-4-(1-pyrrolidinyl)-, 1,1-dioxide, hydrochloride (1:2)