CymitQuimica logo

CAS 1240528-75-9

:

1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(2-methylbutyl)-, hydrochloride (1:2)

Description:
1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(2-methylbutyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole and pyridine moieties, which contribute to its potential biological activity. The presence of the triazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to form hydrogen bonds and interact with biological targets. The N-(2-methylbutyl) substituent enhances lipophilicity, potentially improving the compound's membrane permeability and bioavailability. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating formulation and administration in various applications. The compound's structure may also influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. While specific biological activities and toxicity profiles would require further investigation, the combination of its functional groups suggests potential utility in drug discovery and development. As with any chemical substance, proper handling and safety protocols should be observed due to the potential for biological activity.
Formula:C12H18N4·2ClH
InChI:InChI=1S/C12H18N4.2ClH/c1-3-10(2)8-13-9-12-15-14-11-6-4-5-7-16(11)12;;/h4-7,10,13H,3,8-9H2,1-2H3;2*1H
InChI key:InChIKey=ILCCRHMASSAVLD-UHFFFAOYSA-N
SMILES:C(NCC(CC)C)C=1N2C(=NN1)C=CC=C2.Cl
Synonyms:
  • 1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(2-methylbutyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.