CAS 1240528-99-7

Benzamide, 3-(2-aminoethyl)-, hydrochloride (1:1)

Description:

Benzamide, 3-(2-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and an aminoethyl side chain. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to the free base form. The compound is often used in pharmaceutical research and development, particularly in studies related to neurochemistry and pharmacology, due to its potential biological activity. Its structure suggests that it may interact with various biological targets, making it of interest for medicinal chemistry. As with many amides, it may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to extreme pH levels or high temperatures. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₂N₂O·ClH

InChI: InChI=1S/C9H12N2O.ClH/c10-5-4-7-2-1-3-8(6-7)9(11)12;/h1-3,6H,4-5,10H2,(H2,11,12);1H

InChI key: InChIKey=ATEHRLLCGOTYQB-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(C(N)=O)=CC=C1.Cl

Synonyms:

• Benzamide, 3-(2-aminoethyl)-, hydrochloride (1:1)

3-(2-Aminoethyl)benzamide hydrochloride

CAS: 1240528-99-7

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 200.66 g/mol

Ref: 3D-QZB52899