CAS 1240529-01-4

Benzenesulfonyl chloride, 4-(1,1-dioxido-2-isothiazolidinyl)-

Description:

Benzenesulfonyl chloride, 4-(1,1-dioxido-2-isothiazolidinyl)-, is a chemical compound characterized by the presence of a benzenesulfonyl group attached to a 2-isothiazolidinone moiety. This compound typically exhibits properties associated with both sulfonyl chlorides and isothiazolidines, including reactivity towards nucleophiles due to the electrophilic nature of the sulfonyl chloride functional group. It is likely to be a solid at room temperature and may be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. The presence of the isothiazolidine ring suggests potential biological activity, as such structures are often found in pharmaceuticals and agrochemicals. Additionally, the dioxido group indicates the presence of two oxygen atoms, which may influence the compound's reactivity and stability. Overall, this compound is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Proper handling and storage conditions are essential due to its reactive nature.

Formula: C₉H₁₀ClNO₄S₂

InChI: InChI=1S/C9H10ClNO4S2/c10-17(14,15)9-4-2-8(3-5-9)11-6-1-7-16(11,12)13/h2-5H,1,6-7H2

InChI key: InChIKey=NBMRNUHOCZZUFW-UHFFFAOYSA-N

SMILES: O=S1(=O)N(CCC1)C2=CC=C(S(Cl)(=O)=O)C=C2

Synonyms:

• 4-(1,1-Dioxidoisothiazolidin-2-yl)benzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-(1,1-dioxido-2-isothiazolidinyl)-