
CAS 1240529-38-7
:3-Amino-3-(trifluoromethyl)cyclobutanecarboxylic acid
Description:
3-Amino-3-(trifluoromethyl)cyclobutanecarboxylic acid is a cyclobutane derivative characterized by the presence of an amino group and a trifluoromethyl group attached to the cyclobutane ring. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's chemical behavior, stability, and interactions with other molecules. The presence of the amino group allows for potential hydrogen bonding and can enhance solubility in polar solvents. This compound may exhibit interesting biological activities due to its unique structural features, making it a subject of interest in medicinal chemistry and drug design. Additionally, the cyclobutane ring provides a rigid framework that can affect the conformational flexibility of the molecule, potentially impacting its pharmacokinetic properties. Overall, 3-Amino-3-(trifluoromethyl)cyclobutanecarboxylic acid is a compound with distinctive characteristics that may have various applications in chemical research and development.
Formula:C6H8F3NO2
InChI:InChI=1S/C6H8F3NO2/c7-6(8,9)5(10)1-3(2-5)4(11)12/h3H,1-2,10H2,(H,11,12)
InChI key:InChIKey=PTMDUYZZCSFYHA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(N)CC(C(O)=O)C1
Synonyms:- 3-Amino-3-(trifluoromethyl)cyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 3-amino-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.