
CAS 1240529-46-7
:4-(4-Fluorophenyl)-5-thiazolamine
Description:
4-(4-Fluorophenyl)-5-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, enhancing the compound's potential for biological activity and influencing its physicochemical properties. This compound may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the thiazole moiety's known biological significance. Additionally, the fluorine substitution can affect the compound's lipophilicity and metabolic stability, making it a subject of interest in drug design. As with many thiazole derivatives, it may also possess antimicrobial or anticancer properties, although specific biological activities would require empirical investigation. Safety and handling considerations should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C9H7FN2S
InChI:InChI=1S/C9H7FN2S/c10-7-3-1-6(2-4-7)8-9(11)13-5-12-8/h1-5H,11H2
InChI key:InChIKey=UFSGAXJZAHDSGD-UHFFFAOYSA-N
SMILES:NC1=C(N=CS1)C2=CC=C(F)C=C2
Synonyms:- 4-(4-Fluorophenyl)-5-thiazolamine
- 5-Thiazolamine, 4-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.