CAS 1240529-49-0

1,6-Dihydro-4-methyl-6-oxo[2,2′-bipyrimidine]-5-acetic acid

Description:

1,6-Dihydro-4-methyl-6-oxo[2,2′-bipyrimidine]-5-acetic acid is a chemical compound characterized by its unique bipyrimidine structure, which consists of two pyrimidine rings fused together. This compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its stability and reactivity. The presence of a methyl group and a carboxylic acid functional group (acetic acid) enhances its solubility and potential biological activity. The oxo group (carbonyl) at the 6-position plays a crucial role in its reactivity, potentially participating in various chemical reactions such as nucleophilic attacks. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and biological activity. Overall, the structural features of 1,6-Dihydro-4-methyl-6-oxo[2,2′-bipyrimidine]-5-acetic acid suggest it could be a valuable compound in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₁H₁₀N₄O₃

InChI: InChI=1S/C11H10N4O3/c1-6-7(5-8(16)17)11(18)15-10(14-6)9-12-3-2-4-13-9/h2-4H,5H2,1H3,(H,16,17)(H,14,15,18)

InChI key: InChIKey=BZETVWGAKTXHJZ-UHFFFAOYSA-N

SMILES: CC=1NC(=NC(=O)C1CC(O)=O)C=2N=CC=CN2

Synonyms:

• 1,6-Dihydro-4-methyl-6-oxo[2,2′-bipyrimidine]-5-acetic acid
• [2,2′-Bipyrimidine]-5-acetic acid, 1,6-dihydro-4-methyl-6-oxo-

2-[6-Methyl-4-oxo-2-(pyrimidin-2-yl)-1,4-dihydropyrimidin-5-yl]acetic acid

CAS: 1240529-49-0

2-[6-Methyl-4-oxo-2-(pyrimidin-2-yl)-1,4-dihydropyrimidin-5-yl]acetic acid is a research tool that is used to study protein interactions and receptor binding. It has been shown to be an activator of ion channels, as well as a ligand for the receptor. 2-[6-Methyl-4-oxo-2-(pyrimidin-2-yl)-1,4-dihydropyrimidin-5-yl]acetic acid has been shown to inhibit GPCR activity in vitro, which may lead to the development of new treatments for diseases caused by GPCRs.

Formula: C₁₁H₁₀N₄O₃

Purity: Min. 95%

Molecular weight: 246.22 g/mol

Ref: 3D-QZB52949