CAS 1240529-60-5

1H-Indole-2,3-dione, 5-bromo-1-[2-(diethylamino)ethyl]-, hydrochloride (1:1)

Description:

1H-Indole-2,3-dione, 5-bromo-1-[2-(diethylamino)ethyl]-, hydrochloride (1:1), with CAS number 1240529-60-5, is a chemical compound that features an indole core substituted with a bromine atom and a diethylaminoethyl side chain. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role in drug development. The presence of the indole moiety suggests possible interactions with biological targets, particularly in the realm of neuropharmacology and oncology. The hydrochloride salt form indicates enhanced solubility in aqueous environments, which is beneficial for pharmacological applications. Additionally, the diethylamino group may contribute to the compound's lipophilicity, influencing its ability to cross biological membranes. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₄H₁₇BrN₂O₂·ClH

InChI: InChI=1S/C14H17BrN2O2.ClH/c1-3-16(4-2)7-8-17-12-6-5-10(15)9-11(12)13(18)14(17)19;/h5-6,9H,3-4,7-8H2,1-2H3;1H

InChI key: InChIKey=HOJYYKTUMKKIEA-UHFFFAOYSA-N

SMILES: C(CN(CC)CC)N1C=2C(C(=O)C1=O)=CC(Br)=CC2.Cl

Synonyms:

• 1H-Indole-2,3-dione, 5-bromo-1-[2-(diethylamino)ethyl]-, hydrochloride (1:1)

5-Bromo-1-[2-(diethylamino)ethyl]-2,3-dihydro-1H-indole-2,3-dione hydrochloride

CAS: 1240529-60-5

Versatile small molecule scaffold

Formula: C₁₄H₁₈BrClN₂O₂

Purity: Min. 95%

Molecular weight: 361.66 g/mol

Ref: 3D-QZB52960